| MOQ: | 25kg |
| Price: | USD |
| Payment Terms: | TT |
| Supply Ability: | In Ton |
CAS No: 86123-95-7
BOC-O-METHYL-D-SERINE is a chemical compound with diverse applications. Its molecular formula is C9H17NO5, and its molecular weight is 219.24. The SMILES notation is COCC(C(O)=O)NC(=O)OC(C)(C)C.
Pharmaceutical, Research and Development, Chemical Synthesis.
| TEST ITEM | SPECIFICATION |
|---|---|
| Appearance | White to off-white powder |
| Specific Rotation[α]20/D | -10.0º ~ -16.0º (C=1 in DMF) |
| Melting point | 70℃~80℃ |
| Purity | ≥98.0% |
| Assay | 98.0%~102% |
| Water(KF) | ≤0.5% |