| MOQ: | 25kg |
| Price: | USD |
| Payment Terms: | TT |
| Supply Ability: | In Ton |
DL-Tryptophan is a crucial amino acid used in various applications. Its molecular formula is C11H12N2O2 and its molecular weight is 204.23.
Pharmaceuticals, nutritional supplements, research, and chemical synthesis.
| TEST ITEM | SPECIFICATION |
|---|---|
| Chemical Name or Material | DL-Tryptophan |
| CAS | 54-12-6 |
| Assay Percent Range | 98% |
| Infrared Spectrum | Authentic |
| Beilstein | 22, 550 |
| Other Amino Acids | (TLC) Not detected |
| Packaging | 25kg/barrel |
| SMILES | C1=CC=C2C(=C1)C(=CN2)CC(C(=O)O)N |
| Molecular Weight (g/mol) | 204.229 |
| ChEBI | CHEBI:27897 |
| Physical Form | Crystalline Powder |
| Color | Beige to White or Yellow |
| Name Note | 99% |
| Appearance of Solution | (1% in 1M HCl) clear to slightly hazy, colorless to yellow solution |
| Molecular Formula | C11H12N2O2 |
| MDL Number | MFCD00064339 |
| Loss on Drying | 0.8% max. (105°C, 3 hrs) (vacuum) |
| InChI Key | QIVBCDIJIAJPQS-UHFFFAOYSA-N |
| PubChem CID | 1148 |
| Formula Weight | 204.23 |
| Percent Purity | ≥97.5% |